CAS 2385836-13-3 is the registry number for 2,3-Dibromo-5,6-dimethoxypyrazine, 98%. Offered by: AmBeed. Available pack sizes: 5g.
2,3-dibromo-5,6-dimethoxypyrazine (CAS 2385836-13-3) is a chemical compound with the molecular formula C6H6Br2N2O2 and a molecular weight of 297.93 g/mol. IUPAC name: 2,3-dibromo-5,6-dimethoxypyrazine. InChIKey: DJYIHODFAUYXCZ-UHFFFAOYSA-N.
| Molecular formula | C6H6Br2N2O2 |
|---|---|
| Molecular weight | 297.93 g/mol |
| IUPAC name | 2,3-dibromo-5,6-dimethoxypyrazine |
| InChIKey | DJYIHODFAUYXCZ-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(C(=N1)Br)Br)OC |
Computed by PubChem (NCBI)