Products 2385896-78-4
CAS 2385896-78-4 is the registry number for Methyl 2-bromo-3-chloro-6-iodobenzoate, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 100g.
Methyl 2-bromo-3-chloro-6-iodobenzoate (CAS 2385896-78-4) is a chemical compound with the molecular formula C8H5BrClIO2 and a molecular weight of 375.38 g/mol. IUPAC name: methyl 2-bromo-3-chloro-6-iodobenzoate. InChIKey: ZJYSVPHBFRVXEB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClIO2 |
|---|---|
| Molecular weight | 375.38 g/mol |
| IUPAC name | methyl 2-bromo-3-chloro-6-iodobenzoate |
| InChIKey | ZJYSVPHBFRVXEB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1Br)Cl)I |
Computed by PubChem (NCBI)