Products 2386268-89-7
CAS 2386268-89-7 is the registry number for 3-(carboxymethyl)bicyclo[1.1.1]pentane-1-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-(carboxymethyl)bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2386268-89-7) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. IUPAC name: 3-(carboxymethyl)bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: OXIGGCCPIATTFZ-UHFFFAOYSA-N.
| Molecular formula | C8H10O4 |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | 3-(carboxymethyl)bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | OXIGGCCPIATTFZ-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)C(=O)O)CC(=O)O |
Computed by PubChem (NCBI)