Products 2386356-25-6

CAS 2386356-25-6 is the registry number for 1-bromo-2,5-diethyl-4-iodo-benzene, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-bromo-2,5-diethyl-4-iodobenzene (CAS 2386356-25-6) is a chemical compound with the molecular formula C10H12BrI and a molecular weight of 339.01 g/mol. IUPAC name: 1-bromo-2,5-diethyl-4-iodobenzene. InChIKey: XVWSZHHQWQZDQW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12BrI
Molecular weight339.01 g/mol
IUPAC name1-bromo-2,5-diethyl-4-iodobenzene
InChIKeyXVWSZHHQWQZDQW-UHFFFAOYSA-N
SMILESCCC1=CC(=C(C=C1I)CC)Br

Computed by PubChem (NCBI)