Products 2386588-47-0
CAS 2386588-47-0 is the registry number for tert-Butyl 7-iodo-2,3-dihydro-1H-imidazo[1,5-a]imidazole-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 7-iodo-2,3-dihydroimidazo[1,2-c]imidazole-1-carboxylate (CAS 2386588-47-0) is a chemical compound with the molecular formula C10H14IN3O2 and a molecular weight of 335.14 g/mol. IUPAC name: tert-butyl 7-iodo-2,3-dihydroimidazo[1,2-c]imidazole-1-carboxylate. InChIKey: IRYCDLVVPYQFNB-UHFFFAOYSA-N.
| Molecular formula | C10H14IN3O2 |
|---|---|
| Molecular weight | 335.14 g/mol |
| IUPAC name | tert-butyl 7-iodo-2,3-dihydroimidazo[1,2-c]imidazole-1-carboxylate |
| InChIKey | IRYCDLVVPYQFNB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C1=C(N=C2)I |
Computed by PubChem (NCBI)