CAS 2386908-72-9 is the registry number for tert-Butyl 3-(4-fluoro-3-(trifluoromethyl)phenyl)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-[4-fluoro-3-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate (CAS 2386908-72-9) is a chemical compound with the molecular formula C16H19F4NO2 and a molecular weight of 333.32 g/mol. IUPAC name: tert-butyl 3-[4-fluoro-3-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate. InChIKey: XRDZXMFUNHRJNR-UHFFFAOYSA-N.
| Molecular formula | C16H19F4NO2 |
|---|---|
| Molecular weight | 333.32 g/mol |
| IUPAC name | tert-butyl 3-[4-fluoro-3-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate |
| InChIKey | XRDZXMFUNHRJNR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C2=CC(=C(C=C2)F)C(F)(F)F |
Computed by PubChem (NCBI)