CAS 23870-41-9 is the registry number for Etacrynic Acid Ethyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.
Ethyl 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetate (CAS 23870-41-9) is a chemical compound with the molecular formula C15H16Cl2O4 and a molecular weight of 331.2 g/mol. IUPAC name: ethyl 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetate. InChIKey: ZEMGAZROIIAAMG-UHFFFAOYSA-N.
| Molecular formula | C15H16Cl2O4 |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | ethyl 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetate |
| InChIKey | ZEMGAZROIIAAMG-UHFFFAOYSA-N |
| SMILES | CCC(=C)C(=O)C1=C(C(=C(C=C1)OCC(=O)OCC)Cl)Cl |
Computed by PubChem (NCBI)