Products 23870-41-9

CAS 23870-41-9 is the registry number for Etacrynic Acid Ethyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetate (CAS 23870-41-9) is a chemical compound with the molecular formula C15H16Cl2O4 and a molecular weight of 331.2 g/mol. IUPAC name: ethyl 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetate. InChIKey: ZEMGAZROIIAAMG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16Cl2O4
Molecular weight331.2 g/mol
IUPAC nameethyl 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetate
InChIKeyZEMGAZROIIAAMG-UHFFFAOYSA-N
SMILESCCC(=C)C(=O)C1=C(C(=C(C=C1)OCC(=O)OCC)Cl)Cl

Computed by PubChem (NCBI)