CAS 2387007-06-7 is the registry number for 2-fluoro-6-(trifluoromethyl)-3-(trimethylsilyl)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[2-fluoro-6-(trifluoromethyl)-3-pyridinyl]-trimethylsilane (CAS 2387007-06-7) is a chemical compound with the molecular formula C9H11F4NSi and a molecular weight of 237.27 g/mol. IUPAC name: [2-fluoro-6-(trifluoromethyl)-3-pyridinyl]-trimethylsilane. InChIKey: CIRRJGOCHZQXPA-UHFFFAOYSA-N.
| Molecular formula | C9H11F4NSi |
|---|---|
| Molecular weight | 237.27 g/mol |
| IUPAC name | [2-fluoro-6-(trifluoromethyl)-3-pyridinyl]-trimethylsilane |
| InChIKey | CIRRJGOCHZQXPA-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(N=C(C=C1)C(F)(F)F)F |
Computed by PubChem (NCBI)