CAS 2387071-47-6 appears in our catalog under these names: Dimethachlor CGA 369873, >95% (HPLC), Dimethachlor Metabolite CGA 369873 sodium, Dimethachlor metabolite CGA 369873 sodium 100 µg/mL in Acetonitrile, Dimethachlor Metabolite CGA369873 sodium, Dimethachlor Metabolite CGA 369873, Concentration: 100 µg/ml Solvent: Methanol. Offered by: TRC, Dr. Ehrenstorfer, Sigma-Aldrich, HPC Standards. Available pack sizes: 100mg, 250mg, 25mg, 10mg, 1ml, 1x1ml, 1x10mg.
Sodium 2-(2,6-dimethylanilino)-2-oxoethanesulfonate (CAS 2387071-47-6) is a chemical compound with the molecular formula C10H12NNaO4S and a molecular weight of 265.26 g/mol. IUPAC name: sodium 2-(2,6-dimethylanilino)-2-oxoethanesulfonate. InChIKey: VAVGSERZRIIMLO-UHFFFAOYSA-M.
| Molecular formula | C10H12NNaO4S |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | sodium 2-(2,6-dimethylanilino)-2-oxoethanesulfonate |
| InChIKey | VAVGSERZRIIMLO-UHFFFAOYSA-M |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)