Products 2387130-69-8
CAS 2387130-69-8 is the registry number for 2’-Boc-1’,1’-dimethyl-2’,3’-dihydro-1’H-spiro[cyclopropane-1,4’-isoquinolin]-6’-amine, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 6-amino-1,1-dimethylspiro[3H-isoquinoline-4,1'-cyclopropane]-2-carboxylate (CAS 2387130-69-8) is a chemical compound with the molecular formula C18H26N2O2 and a molecular weight of 302.4 g/mol. IUPAC name: tert-butyl 6-amino-1,1-dimethylspiro[3H-isoquinoline-4,1'-cyclopropane]-2-carboxylate. InChIKey: RCJMIKFTQUFLIX-UHFFFAOYSA-N.
| Molecular formula | C18H26N2O2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | tert-butyl 6-amino-1,1-dimethylspiro[3H-isoquinoline-4,1'-cyclopropane]-2-carboxylate |
| InChIKey | RCJMIKFTQUFLIX-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)N)C3(CC3)CN1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)