Products 2387157-41-5
CAS 2387157-41-5 is the registry number for 1-bromo-3-fluoro-2-iodo-4-(trifluoromethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-3-fluoro-2-iodo-4-(trifluoromethyl)benzene (CAS 2387157-41-5) is a chemical compound with the molecular formula C7H2BrF4I and a molecular weight of 368.89 g/mol. IUPAC name: 1-bromo-3-fluoro-2-iodo-4-(trifluoromethyl)benzene. InChIKey: HKYUSZYKILGWCI-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF4I |
|---|---|
| Molecular weight | 368.89 g/mol |
| IUPAC name | 1-bromo-3-fluoro-2-iodo-4-(trifluoromethyl)benzene |
| InChIKey | HKYUSZYKILGWCI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)F)I)Br |
Computed by PubChem (NCBI)