Products 2387255-75-4

CAS 2387255-75-4 is the registry number for 5-Chloro-4-methylpyrimidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-chloro-4-methylpyrimidine-2-carboxylic acid (CAS 2387255-75-4) is a chemical compound with the molecular formula C6H5ClN2O2 and a molecular weight of 172.57 g/mol. IUPAC name: 5-chloro-4-methylpyrimidine-2-carboxylic acid. InChIKey: XEGQYEQNMTZKJT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClN2O2
Molecular weight172.57 g/mol
IUPAC name5-chloro-4-methylpyrimidine-2-carboxylic acid
InChIKeyXEGQYEQNMTZKJT-UHFFFAOYSA-N
SMILESCC1=NC(=NC=C1Cl)C(=O)O

Computed by PubChem (NCBI)