CAS 2387291-20-3 is the registry number for 4,6-Diisopropyl-2-methylpyrimidin-5-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-4,6-di(propan-2-yl)pyrimidin-5-amine (CAS 2387291-20-3) is a chemical compound with the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. IUPAC name: 2-methyl-4,6-di(propan-2-yl)pyrimidin-5-amine. InChIKey: RYZGYFXMDQCIDA-UHFFFAOYSA-N.
| Molecular formula | C11H19N3 |
|---|---|
| Molecular weight | 193.29 g/mol |
| IUPAC name | 2-methyl-4,6-di(propan-2-yl)pyrimidin-5-amine |
| InChIKey | RYZGYFXMDQCIDA-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C(=N1)C(C)C)N)C(C)C |
Computed by PubChem (NCBI)