Products 2387294-66-6
CAS 2387294-66-6 is the registry number for 2-Bromo-4,6-diisopropylpyrimidin-5-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4,6-di(propan-2-yl)pyrimidin-5-amine (CAS 2387294-66-6) is a chemical compound with the molecular formula C10H16BrN3 and a molecular weight of 258.16 g/mol. IUPAC name: 2-bromo-4,6-di(propan-2-yl)pyrimidin-5-amine. InChIKey: KHXDRIBRBINWMW-UHFFFAOYSA-N.
| Molecular formula | C10H16BrN3 |
|---|---|
| Molecular weight | 258.16 g/mol |
| IUPAC name | 2-bromo-4,6-di(propan-2-yl)pyrimidin-5-amine |
| InChIKey | KHXDRIBRBINWMW-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=NC(=N1)Br)C(C)C)N |
Computed by PubChem (NCBI)