Products 2387505-78-2
CAS 2387505-78-2 appears in our catalog under these names: Calhex 231 hydrochloride, Calhex 231 (hydrochloride), 99.81%, Calhex 231 (hydrochloride), 99%. Offered by: TargetMol, Biosynth, MedChemExpress, Chemat. Available pack sizes: 2mg, 5mg, 25mg, 10mg, 50mg, 100mg, 25 mg, 10 mg.
4-chloro-N-[(1S,2S)-2-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]benzamide;hydrochloride (CAS 2387505-78-2) is a chemical compound with the molecular formula C25H28Cl2N2O and a molecular weight of 443.4 g/mol. IUPAC name: 4-chloro-N-[(1S,2S)-2-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]benzamide;hydrochloride. InChIKey: KZPHZSFSFANQIS-GRFVZBLOSA-N.
| Molecular formula | C25H28Cl2N2O |
|---|---|
| Molecular weight | 443.4 g/mol |
| IUPAC name | 4-chloro-N-[(1S,2S)-2-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]benzamide;hydrochloride |
| InChIKey | KZPHZSFSFANQIS-GRFVZBLOSA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)N[C@H]3CCCC[C@@H]3NC(=O)C4=CC=C(C=C4)Cl.Cl |
Computed by PubChem (NCBI)