CAS 2387559-80-8 is the registry number for Sodium (S)-4-(tert-butoxycarbonyl)piperazine-2-carboxylate, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium (2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylate (CAS 2387559-80-8) is a chemical compound with the molecular formula C10H17N2NaO4 and a molecular weight of 252.24 g/mol. IUPAC name: sodium (2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylate. InChIKey: LVUJZMLWSOMDQT-FJXQXJEOSA-M.
| Molecular formula | C10H17N2NaO4 |
|---|---|
| Molecular weight | 252.24 g/mol |
| IUPAC name | sodium (2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylate |
| InChIKey | LVUJZMLWSOMDQT-FJXQXJEOSA-M |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@@H](C1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)