CAS 2387566-23-4 is the registry number for tert-Butyl (2S,6S)-4-benzyl-2,6-dimethylpiperazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S,6S)-4-benzyl-2,6-dimethylpiperazine-1-carboxylate (CAS 2387566-23-4) is a chemical compound with the molecular formula C18H28N2O2 and a molecular weight of 304.4 g/mol. IUPAC name: tert-butyl (2S,6S)-4-benzyl-2,6-dimethylpiperazine-1-carboxylate. InChIKey: PGCXBVAZNPNHMA-GJZGRUSLSA-N.
| Molecular formula | C18H28N2O2 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | tert-butyl (2S,6S)-4-benzyl-2,6-dimethylpiperazine-1-carboxylate |
| InChIKey | PGCXBVAZNPNHMA-GJZGRUSLSA-N |
| SMILES | C[C@H]1CN(C[C@@H](N1C(=O)OC(C)(C)C)C)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)