CAS 2387596-29-2 is the registry number for 2-Iodo-5-oxo-5H-thiazolo[3,2-a]pyridine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-iodo-5-oxo-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid (CAS 2387596-29-2) is a chemical compound with the molecular formula C8H4INO3S and a molecular weight of 321.09 g/mol. IUPAC name: 2-iodo-5-oxo-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid. InChIKey: YRJMDAQOQBUVHR-UHFFFAOYSA-N.
| Molecular formula | C8H4INO3S |
|---|---|
| Molecular weight | 321.09 g/mol |
| IUPAC name | 2-iodo-5-oxo-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid |
| InChIKey | YRJMDAQOQBUVHR-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N2C(=C1)SC(=C2C(=O)O)I |
Computed by PubChem (NCBI)