CAS 2387597-40-0 is the registry number for 8-Bromo-5-oxo-5H-thiazolo[3,2-a]pyridine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-5-oxo-[1,3]thiazolo[3,2-a]pyridine-2-carboxylic acid (CAS 2387597-40-0) is a chemical compound with the molecular formula C8H4BrNO3S and a molecular weight of 274.09 g/mol. IUPAC name: 8-bromo-5-oxo-[1,3]thiazolo[3,2-a]pyridine-2-carboxylic acid. InChIKey: CSNZOLAVAUXBNN-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO3S |
|---|---|
| Molecular weight | 274.09 g/mol |
| IUPAC name | 8-bromo-5-oxo-[1,3]thiazolo[3,2-a]pyridine-2-carboxylic acid |
| InChIKey | CSNZOLAVAUXBNN-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N2C=C(SC2=C1Br)C(=O)O |
Computed by PubChem (NCBI)