CAS 2387599-94-0 appears in our catalog under these names: 5-Fluoro-2-benzoxazolecarboxylic Acid Sodium Salt, 5-fluoro-1,3-benzoxazole-2-carboxylic acid,sodium salt, 97%, 97%. Offered by: TRC, Chemat. Available pack sizes: 750mg, 100mg, 250mg, 500mg, 1g, 5g, 10g.
CAS 2387599-94-0 identifies a chemical compound with the molecular formula C8H4FNNaO3 and a molecular weight of 204.11 g/mol. InChIKey: PMSQMTDEAWOLAH-UHFFFAOYSA-N.
| Molecular formula | C8H4FNNaO3 |
|---|---|
| Molecular weight | 204.11 g/mol |
| InChIKey | PMSQMTDEAWOLAH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)N=C(O2)C(=O)O.[Na] |
Computed by PubChem (NCBI)