CAS 2387601-17-2 appears in our catalog under these names: 3-Bromo-6,7-dihydro-1,7-naphthyridin-8(5H)-one, 97%, 3-Bromo-6,7-dihydro-1,7-naphthyridin-8(5H)-one, 97%, 97%, 3-BROMO-6,7-DIHYDRO-5H-1,7-NAPHTHYRIDIN-8-ONE, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
3-bromo-6,7-dihydro-5H-1,7-naphthyridin-8-one (CAS 2387601-17-2) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: 3-bromo-6,7-dihydro-5H-1,7-naphthyridin-8-one. InChIKey: IBAZRQHUEWLQHR-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 3-bromo-6,7-dihydro-5H-1,7-naphthyridin-8-one |
| InChIKey | IBAZRQHUEWLQHR-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1C=C(C=N2)Br |
Computed by PubChem (NCBI)