CAS 2387695-88-5 appears in our catalog under these names: 7-Bromo-4-chlorobenzofuro[3,2-d]pyrimidine, 95%, 95%, 7-Bromo-4-chlorobenzofuro[3,2-d]pyrimidine, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-bromo-4-chloro-[1]benzofuro[3,2-d]pyrimidine (CAS 2387695-88-5) is a chemical compound with the molecular formula C10H4BrClN2O and a molecular weight of 283.51 g/mol. IUPAC name: 7-bromo-4-chloro-[1]benzofuro[3,2-d]pyrimidine. InChIKey: DTORWSHUUKIRGA-UHFFFAOYSA-N.
| Molecular formula | C10H4BrClN2O |
|---|---|
| Molecular weight | 283.51 g/mol |
| IUPAC name | 7-bromo-4-chloro-[1]benzofuro[3,2-d]pyrimidine |
| InChIKey | DTORWSHUUKIRGA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)OC3=C2N=CN=C3Cl |
Computed by PubChem (NCBI)