CAS 2387704-62-1 appears in our catalog under these names: Sr-4835, 95%, SR-4835/ 98.03% (existing batch purity), SR–4835, SR 4835, SR-4835 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
N-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]-9-(1-methylpyrazol-4-yl)-2-morpholin-4-ylpurin-6-amine (CAS 2387704-62-1) is a chemical compound with the molecular formula C21H20Cl2N10O and a molecular weight of 499.4 g/mol. IUPAC name: N-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]-9-(1-methylpyrazol-4-yl)-2-morpholin-4-ylpurin-6-amine. InChIKey: FSELUFUYNUNZKD-UHFFFAOYSA-N.
| Molecular formula | C21H20Cl2N10O |
|---|---|
| Molecular weight | 499.4 g/mol |
| IUPAC name | N-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]-9-(1-methylpyrazol-4-yl)-2-morpholin-4-ylpurin-6-amine |
| InChIKey | FSELUFUYNUNZKD-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)N2C=NC3=C(N=C(N=C32)N4CCOCC4)NCC5=NC6=CC(=C(C=C6N5)Cl)Cl |
Computed by PubChem (NCBI)