CAS 23880-57-1 is the registry number for 3-O-Benzyl Estratetraenol. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
(8S,9S,13R,14S)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene (CAS 23880-57-1) is a chemical compound with the molecular formula C25H28O and a molecular weight of 344.5 g/mol. IUPAC name: (8S,9S,13R,14S)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene. InChIKey: VAHVWDBSHRYVAP-NGSHPTGOSA-N.
| Molecular formula | C25H28O |
|---|---|
| Molecular weight | 344.5 g/mol |
| IUPAC name | (8S,9S,13R,14S)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene |
| InChIKey | VAHVWDBSHRYVAP-NGSHPTGOSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC=C2)CCC4=C3C=CC(=C4)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)