CAS 2388477-88-9 is the registry number for 1-((2R,5S)-2,5-Dimethylpiperazin-1-yl)prop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2R,5S)-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one (CAS 2388477-88-9) is a chemical compound with the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. IUPAC name: 1-[(2R,5S)-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one. InChIKey: GBQUXCUNKXKAOH-JGVFFNPUSA-N.
| Molecular formula | C9H16N2O |
|---|---|
| Molecular weight | 168.24 g/mol |
| IUPAC name | 1-[(2R,5S)-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
| InChIKey | GBQUXCUNKXKAOH-JGVFFNPUSA-N |
| SMILES | C[C@@H]1CN[C@H](CN1C(=O)C=C)C |
Computed by PubChem (NCBI)