Products 2388503-71-5
CAS 2388503-71-5 appears in our catalog under these names: rel-Ethyl (2R,3S)-2,3-dimethylcyclopropanecarboxylate, 96.69%, 3-(4-methoxyphenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 500 mg, 50 mg, 250 mg, 100 mg, 100mg, 250mg, 500mg.
Cis-ethyl (2S,3R)-2,3-dimethylcyclopropane-1-carboxylate (CAS 2388503-71-5) is a chemical compound with the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. IUPAC name: cis-ethyl (2S,3R)-2,3-dimethylcyclopropane-1-carboxylate. InChIKey: GIGHGCMJPURZJA-MEKDEQNOSA-N.
| Molecular formula | C8H14O2 |
|---|---|
| Molecular weight | 142.20 g/mol |
| IUPAC name | cis-ethyl (2S,3R)-2,3-dimethylcyclopropane-1-carboxylate |
| InChIKey | GIGHGCMJPURZJA-MEKDEQNOSA-N |
| SMILES | CCOC(=O)C1[C@@H]([C@@H]1C)C |
Computed by PubChem (NCBI)