CAS 2389018-01-1 is the registry number for 5,7-Dibromoisoindolin-1-one, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5,7-dibromo-2,3-dihydroisoindol-1-one (CAS 2389018-01-1) is a chemical compound with the molecular formula C8H5Br2NO and a molecular weight of 290.94 g/mol. IUPAC name: 5,7-dibromo-2,3-dihydroisoindol-1-one. InChIKey: KXXJQGZWFYWHID-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2NO |
|---|---|
| Molecular weight | 290.94 g/mol |
| IUPAC name | 5,7-dibromo-2,3-dihydroisoindol-1-one |
| InChIKey | KXXJQGZWFYWHID-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)Br)Br)C(=O)N1 |
Computed by PubChem (NCBI)