Products 2389078-92-4
CAS 2389078-92-4 is the registry number for Aloc-L-Gln(Trt)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g.
(2S)-5-oxo-2-(prop-2-enoxycarbonylamino)-5-(tritylamino)pentanoic acid (CAS 2389078-92-4) is a chemical compound with the molecular formula C28H28N2O5 and a molecular weight of 472.5 g/mol. IUPAC name: (2S)-5-oxo-2-(prop-2-enoxycarbonylamino)-5-(tritylamino)pentanoic acid. InChIKey: NWAJHWGKAMNYRM-DEOSSOPVSA-N.
| Molecular formula | C28H28N2O5 |
|---|---|
| Molecular weight | 472.5 g/mol |
| IUPAC name | (2S)-5-oxo-2-(prop-2-enoxycarbonylamino)-5-(tritylamino)pentanoic acid |
| InChIKey | NWAJHWGKAMNYRM-DEOSSOPVSA-N |
| SMILES | C=CCOC(=O)N[C@@H](CCC(=O)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)