Products 2390-09-2
CAS 2390-09-2 appears in our catalog under these names: Methyl cis-11-eicosenoate, 95%, Methyl cis-11-Eicosenoate, Methyl cis-11-Eicosenoate, >95% (GC), cis-11-Eicosenoic acid-methyl ester, 11(Z)–Eicosenoic Acid methyl ester. Offered by: Combi-blocks, Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 1g, 250mg, on request, 100mg, 25mg, 50mg, 5g, 100 mg.
Methyl (E)-icos-11-enoate (CAS 2390-09-2) is a chemical compound with the molecular formula C21H40O2 and a molecular weight of 324.5 g/mol. IUPAC name: methyl (E)-icos-11-enoate. InChIKey: RBKMRGOHCLRTLZ-ZHACJKMWSA-N.
| Molecular formula | C21H40O2 |
|---|---|
| Molecular weight | 324.5 g/mol |
| IUPAC name | methyl (E)-icos-11-enoate |
| InChIKey | RBKMRGOHCLRTLZ-ZHACJKMWSA-N |
| SMILES | CCCCCCCC/C=C/CCCCCCCCCC(=O)OC |
Computed by PubChem (NCBI)