Products 239095-84-2
CAS 239095-84-2 is the registry number for 2，3–Dibromo–6，7–Dichloroquinoxaline. Offered by: GLPBio. Available pack sizes: 250mg.
2,3-dibromo-6,7-dichloro-1,2,3,4-tetrahydroquinoxaline (CAS 239095-84-2) is a chemical compound with the molecular formula C8H6Br2Cl2N2 and a molecular weight of 360.86 g/mol. IUPAC name: 2,3-dibromo-6,7-dichloro-1,2,3,4-tetrahydroquinoxaline. InChIKey: RQOASEPGDQTBCL-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2Cl2N2 |
|---|---|
| Molecular weight | 360.86 g/mol |
| IUPAC name | 2,3-dibromo-6,7-dichloro-1,2,3,4-tetrahydroquinoxaline |
| InChIKey | RQOASEPGDQTBCL-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)NC(C(N2)Br)Br |
Computed by PubChem (NCBI)