CAS 23912-79-0 appears in our catalog under these names: 5,7,12,14-Pentacenetetrone, 95%, 5,7,12,14-Pentacenetetrone, 98%, 5,7,12,14–Pentacenetetrone, 5,7,12,14-Pentacenetetrone, 95% , 5,7,12,14-Pentacenetetrone. Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 5g, 25g, 10g, 250mg.
Pentacene-5,7,12,14-tetrone (CAS 23912-79-0) is a chemical compound with the molecular formula C22H10O4 and a molecular weight of 338.3 g/mol. IUPAC name: pentacene-5,7,12,14-tetrone. InChIKey: YZOGOBWHTVNKGA-UHFFFAOYSA-N.
| Molecular formula | C22H10O4 |
|---|---|
| Molecular weight | 338.3 g/mol |
| IUPAC name | pentacene-5,7,12,14-tetrone |
| InChIKey | YZOGOBWHTVNKGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC4=C(C=C3C2=O)C(=O)C5=CC=CC=C5C4=O |
Computed by PubChem (NCBI)