Products 23914-40-1

CAS 23914-40-1 is the registry number for (E)-1,2-Bis(2,6-dichlorophenyl)diazene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Bis(2,6-dichlorophenyl)diazene (CAS 23914-40-1) is a chemical compound with the molecular formula C12H6Cl4N2 and a molecular weight of 320.0 g/mol. IUPAC name: bis(2,6-dichlorophenyl)diazene. InChIKey: HJGINCCDXUFCLF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H6Cl4N2
Molecular weight320.0 g/mol
IUPAC namebis(2,6-dichlorophenyl)diazene
InChIKeyHJGINCCDXUFCLF-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)N=NC2=C(C=CC=C2Cl)Cl)Cl

Computed by PubChem (NCBI)

Synonyms: 621-cis