CAS 23914-40-1 is the registry number for (E)-1,2-Bis(2,6-dichlorophenyl)diazene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Bis(2,6-dichlorophenyl)diazene (CAS 23914-40-1) is a chemical compound with the molecular formula C12H6Cl4N2 and a molecular weight of 320.0 g/mol. IUPAC name: bis(2,6-dichlorophenyl)diazene. InChIKey: HJGINCCDXUFCLF-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl4N2 |
|---|---|
| Molecular weight | 320.0 g/mol |
| IUPAC name | bis(2,6-dichlorophenyl)diazene |
| InChIKey | HJGINCCDXUFCLF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N=NC2=C(C=CC=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)