CAS 23920-08-3 appears in our catalog under these names: 2,4-Dichloropyrimidine-5-sulfonylchloride, 95%, 95%, 2,4-Dichloropyrimidine-5-sulfonyl chloride, >95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4-dichloropyrimidine-5-sulfonyl chloride (CAS 23920-08-3) is a chemical compound with the molecular formula C4HCl3N2O2S and a molecular weight of 247.5 g/mol. IUPAC name: 2,4-dichloropyrimidine-5-sulfonyl chloride. InChIKey: ZPTJJFUQGKXOKC-UHFFFAOYSA-N.
| Molecular formula | C4HCl3N2O2S |
|---|---|
| Molecular weight | 247.5 g/mol |
| IUPAC name | 2,4-dichloropyrimidine-5-sulfonyl chloride |
| InChIKey | ZPTJJFUQGKXOKC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)