Products 23927-13-1
CAS 23927-13-1 appears in our catalog under these names: Cyclo(–D–Ala–D–Ala), Cyclo(-d-ala-d-ala), 98%, Cyclo(-D-Ala-D-Ala), ≥98%, ≥98%. Offered by: GLPBio, AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
(3R,6R)-3,6-dimethylpiperazine-2,5-dione (CAS 23927-13-1) is a chemical compound with the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. IUPAC name: (3R,6R)-3,6-dimethylpiperazine-2,5-dione. InChIKey: WWISPHBAYBECQZ-QWWZWVQMSA-N.
| Molecular formula | C6H10N2O2 |
|---|---|
| Molecular weight | 142.16 g/mol |
| IUPAC name | (3R,6R)-3,6-dimethylpiperazine-2,5-dione |
| InChIKey | WWISPHBAYBECQZ-QWWZWVQMSA-N |
| SMILES | C[C@@H]1C(=O)N[C@@H](C(=O)N1)C |
Computed by PubChem (NCBI)
Synonyms:
D-Alanine anhydride, Cyclo(D-alanyl-D-alanyl), Alanine anhydride, cis-(+)-, 2,5-Piperazinedione, 3,6-dimethyl-, (3R,6R)-, 2,5-Piperazinedione, 3,6-dimethyl-, (3R-cis)-, Cyclo(-D-Ala-D-Ala), (3R,6R)-3,6-dimethylpiperazine-2,5-dione, Cyclo(D-Ala-D-Ala), (3R,6R)-Dimethyl-piperazine-2,5-dione, starbld0009559