CAS 2392930-05-9 is the registry number for 2-Chloro-4,6-bis(1-dibenzofuranyl)-1,3,5-triazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-chloro-4,6-di(dibenzofuran-1-yl)-1,3,5-triazine (CAS 2392930-05-9) is a chemical compound with the molecular formula C27H14ClN3O2 and a molecular weight of 447.9 g/mol. IUPAC name: 2-chloro-4,6-di(dibenzofuran-1-yl)-1,3,5-triazine. InChIKey: SBIPKOFLAZZMFZ-UHFFFAOYSA-N.
| Molecular formula | C27H14ClN3O2 |
|---|---|
| Molecular weight | 447.9 g/mol |
| IUPAC name | 2-chloro-4,6-di(dibenzofuran-1-yl)-1,3,5-triazine |
| InChIKey | SBIPKOFLAZZMFZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CC=C3O2)C4=NC(=NC(=N4)Cl)C5=C6C7=CC=CC=C7OC6=CC=C5 |
Computed by PubChem (NCBI)