CAS 2393894-35-2 is the registry number for Co(acac)(dppe), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cobalt(2+);2-diphenylphosphaniumylethyl(diphenyl)phosphanium;pentane-2,4-dione (CAS 2393894-35-2) is a chemical compound with the molecular formula C31H33CoO2P2+3 and a molecular weight of 558.5 g/mol. IUPAC name: cobalt(2+);2-diphenylphosphaniumylethyl(diphenyl)phosphanium;pentane-2,4-dione. InChIKey: RMCFKRKBCRFTGC-UHFFFAOYSA-P.
| Molecular formula | C31H33CoO2P2+3 |
|---|---|
| Molecular weight | 558.5 g/mol |
| IUPAC name | cobalt(2+);2-diphenylphosphaniumylethyl(diphenyl)phosphanium;pentane-2,4-dione |
| InChIKey | RMCFKRKBCRFTGC-UHFFFAOYSA-P |
| SMILES | CC(=O)[CH-]C(=O)C.C1=CC=C(C=C1)[PH+](CC[PH+](C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.[Co+2] |
Computed by PubChem (NCBI)