Products 239440-86-9
CAS 239440-86-9 is the registry number for trans,trans-2,4-Nonadienal-D2. Offered by: TRC. Available pack sizes: 10mg.
(2E,4E)-3,4-dideuterionona-2,4-dienal (CAS 239440-86-9) is a chemical compound with the molecular formula C9H14O and a molecular weight of 140.22 g/mol. IUPAC name: (2E,4E)-3,4-dideuterionona-2,4-dienal. InChIKey: ZHHYXNZJDGDGPJ-GZPSEYJASA-N.
| Molecular formula | C9H14O |
|---|---|
| Molecular weight | 140.22 g/mol |
| IUPAC name | (2E,4E)-3,4-dideuterionona-2,4-dienal |
| InChIKey | ZHHYXNZJDGDGPJ-GZPSEYJASA-N |
| SMILES | [2H]/C(=C\CCCC)/C(=C/C=O)/[2H] |
Computed by PubChem (NCBI)