CAS 239463-93-5 is the registry number for 2-(Trifluoromethylthio)benzyl alcohol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(trifluoromethylsulfanyl)phenyl]methanol (CAS 239463-93-5) is a chemical compound with the molecular formula C8H7F3OS and a molecular weight of 208.20 g/mol. IUPAC name: [2-(trifluoromethylsulfanyl)phenyl]methanol. InChIKey: IZKPDCFEJFNLJD-UHFFFAOYSA-N.
| Molecular formula | C8H7F3OS |
|---|---|
| Molecular weight | 208.20 g/mol |
| IUPAC name | [2-(trifluoromethylsulfanyl)phenyl]methanol |
| InChIKey | IZKPDCFEJFNLJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CO)SC(F)(F)F |
Computed by PubChem (NCBI)