CAS 239463-95-7 appears in our catalog under these names: 4,5,5,6,6,6-Hexafluoro-4-(trifluoromethyl)hexanoic acid, 95%, 4,5,5,6,6,6-Hexafluoro-4-(trifluoromethyl)hexanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4,5,5,6,6,6-hexafluoro-4-(trifluoromethyl)hexanoic acid (CAS 239463-95-7) is a chemical compound with the molecular formula C7H5F9O2 and a molecular weight of 292.10 g/mol. IUPAC name: 4,5,5,6,6,6-hexafluoro-4-(trifluoromethyl)hexanoic acid. InChIKey: IYOGFVCBZQWDQL-UHFFFAOYSA-N.
| Molecular formula | C7H5F9O2 |
|---|---|
| Molecular weight | 292.10 g/mol |
| IUPAC name | 4,5,5,6,6,6-hexafluoro-4-(trifluoromethyl)hexanoic acid |
| InChIKey | IYOGFVCBZQWDQL-UHFFFAOYSA-N |
| SMILES | C(CC(C(C(F)(F)F)(F)F)(C(F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)