Products 239464-02-9
CAS 239464-02-9 is the registry number for 1,1,1,2,2,3-Hexafluoro-3-(trifluoromethyl)-5-iodopentane, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)pentane (CAS 239464-02-9) is a chemical compound with the molecular formula C6H4F9I and a molecular weight of 373.99 g/mol. IUPAC name: 1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)pentane. InChIKey: AOJSNAHJSVDKPI-UHFFFAOYSA-N.
| Molecular formula | C6H4F9I |
|---|---|
| Molecular weight | 373.99 g/mol |
| IUPAC name | 1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)pentane |
| InChIKey | AOJSNAHJSVDKPI-UHFFFAOYSA-N |
| SMILES | C(CI)C(C(C(F)(F)F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)