CAS 239466-39-8 is the registry number for (2E)-2-(4-Oxo-1-trityl-3-piperidinylidene)acetic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
Ethyl (2E)-2-(4-oxo-1-tritylpiperidin-3-ylidene)acetate (CAS 239466-39-8) is a chemical compound with the molecular formula C28H27NO3 and a molecular weight of 425.5 g/mol. IUPAC name: ethyl (2E)-2-(4-oxo-1-tritylpiperidin-3-ylidene)acetate. InChIKey: RAOJUCCEQKKMBR-LSDHQDQOSA-N.
| Molecular formula | C28H27NO3 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | ethyl (2E)-2-(4-oxo-1-tritylpiperidin-3-ylidene)acetate |
| InChIKey | RAOJUCCEQKKMBR-LSDHQDQOSA-N |
| SMILES | CCOC(=O)/C=C/1\CN(CCC1=O)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)