CAS 2395-00-8 is the registry number for Potassium perfluorooctanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Potassium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate (CAS 2395-00-8) is a chemical compound with the molecular formula C8F15KO2 and a molecular weight of 452.16 g/mol. IUPAC name: potassium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate. InChIKey: WPDDXKNWUVLZMQ-UHFFFAOYSA-M.
| Molecular formula | C8F15KO2 |
|---|---|
| Molecular weight | 452.16 g/mol |
| IUPAC name | potassium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
| InChIKey | WPDDXKNWUVLZMQ-UHFFFAOYSA-M |
| SMILES | C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)[O-].[K+] |
Computed by PubChem (NCBI)