Products 2395009-13-7
CAS 2395009-13-7 is the registry number for Anticancer agent 48. Offered by: MedChemExpress. Available pack sizes: Get quote.
[1-(3-aminophenyl)-4-(4-aminophenyl)pyrrol-3-yl]-(3,4,5-trimethoxyphenyl)methanone (CAS 2395009-13-7) is a chemical compound with the molecular formula C26H25N3O4 and a molecular weight of 443.5 g/mol. IUPAC name: [1-(3-aminophenyl)-4-(4-aminophenyl)pyrrol-3-yl]-(3,4,5-trimethoxyphenyl)methanone. InChIKey: HWEPQWQOQSZLRC-UHFFFAOYSA-N.
| Molecular formula | C26H25N3O4 |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | [1-(3-aminophenyl)-4-(4-aminophenyl)pyrrol-3-yl]-(3,4,5-trimethoxyphenyl)methanone |
| InChIKey | HWEPQWQOQSZLRC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)C2=CN(C=C2C3=CC=C(C=C3)N)C4=CC=CC(=C4)N |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 48, orb1687442