CAS 23964-57-0 appears in our catalog under these names: Articaine hydrochloride, 95%, Articaine HCl, Articaine Hydrochloride, Articaine Hydrochloride, >95% (HPLC), Articaine hydrochloride/ 99.88% (existing batch purity). Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: 1g, 250mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 4-methyl-3-[2-(propylamino)propanoylamino]thiophene-2-carboxylate;hydrochloride (CAS 23964-57-0) is a chemical compound with the molecular formula C13H21ClN2O3S and a molecular weight of 320.84 g/mol. IUPAC name: methyl 4-methyl-3-[2-(propylamino)propanoylamino]thiophene-2-carboxylate;hydrochloride. InChIKey: GDWDBGSWGNEMGJ-UHFFFAOYSA-N.
| Molecular formula | C13H21ClN2O3S |
|---|---|
| Molecular weight | 320.84 g/mol |
| IUPAC name | methyl 4-methyl-3-[2-(propylamino)propanoylamino]thiophene-2-carboxylate;hydrochloride |
| InChIKey | GDWDBGSWGNEMGJ-UHFFFAOYSA-N |
| SMILES | CCCNC(C)C(=O)NC1=C(SC=C1C)C(=O)OC.Cl |
Computed by PubChem (NCBI)