CAS 2396465-78-2 is the registry number for ((1R,3R)-3-Aminocyclopentyl)dimethylphosphine oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,3R)-3-dimethylphosphorylcyclopentan-1-amine (CAS 2396465-78-2) is a chemical compound with the molecular formula C7H16NOP and a molecular weight of 161.18 g/mol. IUPAC name: trans-(1R,3R)-3-dimethylphosphorylcyclopentan-1-amine. InChIKey: HQOXZKIEDCPABW-RNFRBKRXSA-N.
| Molecular formula | C7H16NOP |
|---|---|
| Molecular weight | 161.18 g/mol |
| IUPAC name | trans-(1R,3R)-3-dimethylphosphorylcyclopentan-1-amine |
| InChIKey | HQOXZKIEDCPABW-RNFRBKRXSA-N |
| SMILES | CP(=O)(C)[C@@H]1CC[C@H](C1)N |
Computed by PubChem (NCBI)