Products 2396558-52-2
CAS 2396558-52-2 is the registry number for 7-(3-Bromophenyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(3-bromophenyl)pyrrolo[2,3-d]pyrimidin-2-amine (CAS 2396558-52-2) is a chemical compound with the molecular formula C12H9BrN4 and a molecular weight of 289.13 g/mol. IUPAC name: 7-(3-bromophenyl)pyrrolo[2,3-d]pyrimidin-2-amine. InChIKey: STDMAQQDSPUKBD-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN4 |
|---|---|
| Molecular weight | 289.13 g/mol |
| IUPAC name | 7-(3-bromophenyl)pyrrolo[2,3-d]pyrimidin-2-amine |
| InChIKey | STDMAQQDSPUKBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)N2C=CC3=CN=C(N=C32)N |
Computed by PubChem (NCBI)