Products 2396691-28-2
CAS 2396691-28-2 is the registry number for DNMT-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S)-3-bromo-3-nitro-2-(2-nitrophenyl)-2H-chromen-4-one (CAS 2396691-28-2) is a chemical compound with the molecular formula C15H9BrN2O6 and a molecular weight of 393.14 g/mol. IUPAC name: (2R,3S)-3-bromo-3-nitro-2-(2-nitrophenyl)-2H-chromen-4-one. InChIKey: QDGZPZFFDOYRGY-CABCVRRESA-N.
| Molecular formula | C15H9BrN2O6 |
|---|---|
| Molecular weight | 393.14 g/mol |
| IUPAC name | (2R,3S)-3-bromo-3-nitro-2-(2-nitrophenyl)-2H-chromen-4-one |
| InChIKey | QDGZPZFFDOYRGY-CABCVRRESA-N |
| SMILES | C1=CC=C(C(=C1)[C@@H]2[C@](C(=O)C3=CC=CC=C3O2)([N+](=O)[O-])Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)