CAS 23967-57-9 appears in our catalog under these names: 4–Chlorobenzo(b)thiophene–2–carboxylic Acid, 4-Chlorobenzo[b]thiophene-2-carboxylic Acid, >97.0%(GC), 4-Chlorobenzo[b]thiophene-2-carboxylic acid, 90%, 90%, 4-Chloro-benzo[b]thiophene-2-carboxylic acid, 98%, 4-Chlorobenzo[b]thiophene-2-carboxylic acid, 90%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
4-chloro-1-benzothiophene-2-carboxylate (CAS 23967-57-9) is a chemical compound with the molecular formula C9H4ClO2S- and a molecular weight of 211.65 g/mol. IUPAC name: 4-chloro-1-benzothiophene-2-carboxylate. InChIKey: IPAXPERGAMNMIJ-UHFFFAOYSA-M.
| Molecular formula | C9H4ClO2S- |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | 4-chloro-1-benzothiophene-2-carboxylate |
| InChIKey | IPAXPERGAMNMIJ-UHFFFAOYSA-M |
| SMILES | C1=CC2=C(C=C(S2)C(=O)[O-])C(=C1)Cl |
Computed by PubChem (NCBI)