CAS 2396706-31-1 is the registry number for GAK inhibitor 2, 98.58%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 10 mg, 50 mg, 25 mg, 5 mg.
(2R,6S)-4-[5-(3,4-dimethoxyphenyl)-[1,2]thiazolo[4,3-b]pyridin-3-yl]-2,6-dimethylmorpholine (CAS 2396706-31-1) is a chemical compound with the molecular formula C20H23N3O3S and a molecular weight of 385.5 g/mol. IUPAC name: (2R,6S)-4-[5-(3,4-dimethoxyphenyl)-[1,2]thiazolo[4,3-b]pyridin-3-yl]-2,6-dimethylmorpholine. InChIKey: BVEGTKGHXUUTRR-BETUJISGSA-N.
| Molecular formula | C20H23N3O3S |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | (2R,6S)-4-[5-(3,4-dimethoxyphenyl)-[1,2]thiazolo[4,3-b]pyridin-3-yl]-2,6-dimethylmorpholine |
| InChIKey | BVEGTKGHXUUTRR-BETUJISGSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)C2=C3C(=NS2)C=CC(=N3)C4=CC(=C(C=C4)OC)OC |
Computed by PubChem (NCBI)