CAS 2396769-72-3 is the registry number for N-(6-Chloro-2-(2,2,2-trifluoroethoxy)pyridin-3-yl)-2,2,2-trifluoroacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[6-chloro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]-2,2,2-trifluoroacetamide (CAS 2396769-72-3) is a chemical compound with the molecular formula C9H5ClF6N2O2 and a molecular weight of 322.59 g/mol. IUPAC name: N-[6-chloro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]-2,2,2-trifluoroacetamide. InChIKey: LWODWQIEBVCUSB-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF6N2O2 |
|---|---|
| Molecular weight | 322.59 g/mol |
| IUPAC name | N-[6-chloro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]-2,2,2-trifluoroacetamide |
| InChIKey | LWODWQIEBVCUSB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1NC(=O)C(F)(F)F)OCC(F)(F)F)Cl |
Computed by PubChem (NCBI)